C23H27N3O3S2 — CID 89008322
2-[3-[1-(4-propan-2-ylsulfanylphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-c]pyridin-1-yl]acetaldehyde (PubChem CID 89008322) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-[3-[1-(4-propan-2-ylsulfanylphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-c]pyridin-1-yl]acetaldehyde.
| Compound Name | 2-[3-[1-(4-propan-2-ylsulfanylphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-c]pyridin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 89008322 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[3-[1-(4-propan-2-ylsulfanylphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-c]pyridin-1-yl]acetaldehyde |
| SMILES | CC(C)Sc1ccc(S(=O)(=O)N2CCC(c3cn(CC=O)c4cnccc34)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S2/c1-17(2)30-19-3-5-20(6-4-19)31(28,29)26-11-8-18(9-12-26)22-16-25(13-14-27)23-15-24-10-7-21(22)23/h3-7,10,14-18H,8-9,11-13H2,1-2H3 |
| InChIKey | COJPGGIYKAJELC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|