C22H25BrN4O5S — CID 59559554
2-[6-bromo-3-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid (PubChem CID 59559554) has the molecular formula C22H25BrN4O5S and a molecular weight of 537.44 g/mol. Its IUPAC name is 2-[6-bromo-3-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid.
| Compound Name | 2-[6-bromo-3-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59559554 |
| Molecular Formula | C22H25BrN4O5S |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 2-[6-bromo-3-[4-(4-propan-2-yloxyphenyl)sulfonylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]acetic acid |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCN(c3cn(CC(=O)O)c4nc(Br)ccc34)CC2)cc1 |
| InChI | InChI=1S/C22H25BrN4O5S/c1-15(2)32-16-3-5-17(6-4-16)33(30,31)27-11-9-25(10-12-27)19-13-26(14-21(28)29)22-18(19)7-8-20(23)24-22/h3-8,13,15H,9-12,14H2,1-2H3,(H,28,29) |
| InChIKey | VAOBMLVLBCLQER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|