C22H26BrN3O6S2 — CID 58130160
[6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methanesulfonic acid (PubChem CID 58130160) has the molecular formula C22H26BrN3O6S2 and a molecular weight of 572.50 g/mol. Its IUPAC name is [6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methanesulfonic acid.
| Compound Name | [6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 58130160 |
| Molecular Formula | C22H26BrN3O6S2 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | [6-bromo-3-[1-(4-propan-2-yloxyphenyl)sulfonylpiperidin-4-yl]pyrrolo[2,3-b]pyridin-1-yl]methanesulfonic acid |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCC(c3cn(CS(=O)(=O)O)c4nc(Br)ccc34)CC2)cc1 |
| InChI | InChI=1S/C22H26BrN3O6S2/c1-15(2)32-17-3-5-18(6-4-17)34(30,31)26-11-9-16(10-12-26)20-13-25(14-33(27,28)29)22-19(20)7-8-21(23)24-22/h3-8,13,15-16H,9-12,14H2,1-2H3,(H,27,28,29) |
| InChIKey | BMNKOAXYRJGGSG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|