C22H24N2O4S — CID 53213423
1-[1-[(4-methylphenyl)methyl]indol-5-yl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 53213423) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[1-[(4-methylphenyl)methyl]indol-5-yl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-[1-[(4-methylphenyl)methyl]indol-5-yl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53213423 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-[1-[(4-methylphenyl)methyl]indol-5-yl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | Cc1ccc(Cn2ccc3cc(S(=O)(=O)N4CCC(C(=O)O)CC4)ccc32)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-16-2-4-17(5-3-16)15-23-11-8-19-14-20(6-7-21(19)23)29(27,28)24-12-9-18(10-13-24)22(25)26/h2-8,11,14,18H,9-10,12-13,15H2,1H3,(H,25,26) |
| InChIKey | HBSJNWLVCKAXRA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |