C21H23N3O2 — CID 118148213
methyl 4-[(6-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzoate (PubChem CID 118148213) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 4-[(6-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzoate.
| Compound Name | methyl 4-[(6-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 118148213 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | methyl 4-[(6-piperidin-4-ylpyrrolo[2,3-b]pyridin-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2ccc3ccc(C4CCNCC4)nc32)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-26-21(25)18-4-2-15(3-5-18)14-24-13-10-17-6-7-19(23-20(17)24)16-8-11-22-12-9-16/h2-7,10,13,16,22H,8-9,11-12,14H2,1H3 |
| InChIKey | KIJBGCGMEYZMBV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |