C32H37N5O4 — CID 129128675
[4-[1-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperidin-1-yl]-[3-(morpholin-4-ylmethyl)phenyl]methanone (PubChem CID 129128675) has the molecular formula C32H37N5O4 and a molecular weight of 555.68 g/mol. Its IUPAC name is [4-[1-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperidin-1-yl]-[3-(morpholin-4-ylmethyl)phenyl]methanone.
| Compound Name | [4-[1-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperidin-1-yl]-[3-(morpholin-4-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 129128675 |
| Molecular Formula | C32H37N5O4 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | [4-[1-[[4-[hydroxy-(hydroxyamino)methyl]phenyl]methyl]pyrrolo[2,3-b]pyridin-5-yl]piperidin-1-yl]-[3-(morpholin-4-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(CN2CCOCC2)c1)N1CCC(c2cnc3c(ccn3Cc3ccc(C(O)NO)cc3)c2)CC1 |
| InChI | InChI=1S/C32H37N5O4/c38-31(34-40)26-6-4-23(5-7-26)22-37-13-10-27-19-29(20-33-30(27)37)25-8-11-36(12-9-25)32(39)28-3-1-2-24(18-28)21-35-14-16-41-17-15-35/h1-7,10,13,18-20,25,31,34,38,40H,8-9,11-12,14-17,21-22H2 |
| InChIKey | JOPAFMNFVFGJQQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|