C24H22F3N3O — CID 95819693
2-phenyl-1-[(3R)-3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone (PubChem CID 95819693) has the molecular formula C24H22F3N3O and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-phenyl-1-[(3R)-3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[(3R)-3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95819693 |
| Molecular Formula | C24H22F3N3O |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-phenyl-1-[(3R)-3-[6-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCC[C@@H](c2cncc(-c3cccc(C(F)(F)F)c3)n2)C1 |
| InChI | InChI=1S/C24H22F3N3O/c25-24(26,27)20-10-4-8-18(13-20)21-14-28-15-22(29-21)19-9-5-11-30(16-19)23(31)12-17-6-2-1-3-7-17/h1-4,6-8,10,13-15,19H,5,9,11-12,16H2/t19-/m1/s1 |
| InChIKey | GNGGOBLFUDONSG-LJQANCHMSA-N |
| XLogP | 5.11 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |