C21H25N3O3 — CID 110120354
3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid (PubChem CID 110120354) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid.
| Compound Name | 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 110120354 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid |
| SMILES | CC(C)(C)C(=O)N1CCCC(c2cncc(-c3cccc(C(=O)O)c3)n2)C1 |
| InChI | InChI=1S/C21H25N3O3/c1-21(2,3)20(27)24-9-5-8-16(13-24)18-12-22-11-17(23-18)14-6-4-7-15(10-14)19(25)26/h4,6-7,10-12,16H,5,8-9,13H2,1-3H3,(H,25,26) |
| InChIKey | RFXCSCNUXHDIFP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |