C18H22N4O4S — CID 110120298
3-[6-[1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid (PubChem CID 110120298) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 3-[6-[1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid.
| Compound Name | 3-[6-[1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 110120298 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[6-[1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzoic acid |
| SMILES | CN(C)S(=O)(=O)N1CCCC(c2cncc(-c3cccc(C(=O)O)c3)n2)C1 |
| InChI | InChI=1S/C18H22N4O4S/c1-21(2)27(25,26)22-8-4-7-15(12-22)17-11-19-10-16(20-17)13-5-3-6-14(9-13)18(23)24/h3,5-6,9-11,15H,4,7-8,12H2,1-2H3,(H,23,24) |
| InChIKey | JDOCTITZMZDICV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |