C18H23N5O3S — CID 95819022
3-[3-[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzamide (PubChem CID 95819022) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-[3-[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzamide.
| Compound Name | 3-[3-[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 95819022 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-[3-[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@H](c2nccnc2-c2cccc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C18H23N5O3S/c1-22(2)27(25,26)23-10-4-7-15(12-23)17-16(20-8-9-21-17)13-5-3-6-14(11-13)18(19)24/h3,5-6,8-9,11,15H,4,7,10,12H2,1-2H3,(H2,19,24)/t15-/m1/s1 |
| InChIKey | RZIKARALEVLAFO-OAHLLOKOSA-N |
| XLogP | 1.23 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |