C24H26N4O — CID 95818755
3-[3-[(3S)-1-(2-phenylethyl)piperidin-3-yl]pyrazin-2-yl]benzamide (PubChem CID 95818755) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[3-[(3S)-1-(2-phenylethyl)piperidin-3-yl]pyrazin-2-yl]benzamide.
| Compound Name | 3-[3-[(3S)-1-(2-phenylethyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 95818755 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[3-[(3S)-1-(2-phenylethyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2nccnc2[C@H]2CCCN(CCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C24H26N4O/c25-24(29)20-9-4-8-19(16-20)22-23(27-13-12-26-22)21-10-5-14-28(17-21)15-11-18-6-2-1-3-7-18/h1-4,6-9,12-13,16,21H,5,10-11,14-15,17H2,(H2,25,29)/t21-/m0/s1 |
| InChIKey | HTHNGPXGMWBGAJ-NRFANRHFSA-N |
| XLogP | 3.66 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |