C22H27N5O3 — CID 110255104
3-[3-[1-(2-morpholin-4-ylacetyl)piperidin-3-yl]pyrazin-2-yl]benzamide (PubChem CID 110255104) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[3-[1-(2-morpholin-4-ylacetyl)piperidin-3-yl]pyrazin-2-yl]benzamide.
| Compound Name | 3-[3-[1-(2-morpholin-4-ylacetyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 110255104 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 3-[3-[1-(2-morpholin-4-ylacetyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2nccnc2C2CCCN(C(=O)CN3CCOCC3)C2)c1 |
| InChI | InChI=1S/C22H27N5O3/c23-22(29)17-4-1-3-16(13-17)20-21(25-7-6-24-20)18-5-2-8-27(14-18)19(28)15-26-9-11-30-12-10-26/h1,3-4,6-7,13,18H,2,5,8-12,14-15H2,(H2,23,29) |
| InChIKey | LEPBLYONGLZOJO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |