C21H25FN4O2 — CID 95819220
1-[(3S)-3-[3-(4-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone (PubChem CID 95819220) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[(3S)-3-[3-(4-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[(3S)-3-[3-(4-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 95819220 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[(3S)-3-[3-(4-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-2-morpholin-4-ylethanone |
| SMILES | O=C(CN1CCOCC1)N1CCC[C@H](c2nccnc2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H25FN4O2/c22-18-5-3-16(4-6-18)20-21(24-8-7-23-20)17-2-1-9-26(14-17)19(27)15-25-10-12-28-13-11-25/h3-8,17H,1-2,9-15H2/t17-/m0/s1 |
| InChIKey | QUZXVUBHKQAJJJ-KRWDZBQOSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |