C22H21N5O2 — CID 95818967
3-[3-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]pyrazin-2-yl]benzamide (PubChem CID 95818967) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[3-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]pyrazin-2-yl]benzamide.
| Compound Name | 3-[3-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 95818967 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-[3-[(3R)-1-(pyridine-4-carbonyl)piperidin-3-yl]pyrazin-2-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2nccnc2[C@@H]2CCCN(C(=O)c3ccncc3)C2)c1 |
| InChI | InChI=1S/C22H21N5O2/c23-21(28)17-4-1-3-16(13-17)19-20(26-11-10-25-19)18-5-2-12-27(14-18)22(29)15-6-8-24-9-7-15/h1,3-4,6-11,13,18H,2,5,12,14H2,(H2,23,28)/t18-/m1/s1 |
| InChIKey | UJDLGHDONGOXGE-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |