C22H26N2O3 — CID 124965145
3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid (PubChem CID 124965145) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid.
| Compound Name | 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 124965145 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid |
| SMILES | CC(C)(C)C(=O)N1CCC[C@@H](c2cc(-c3cccc(C(=O)O)c3)ccn2)C1 |
| InChI | InChI=1S/C22H26N2O3/c1-22(2,3)21(27)24-11-5-8-18(14-24)19-13-16(9-10-23-19)15-6-4-7-17(12-15)20(25)26/h4,6-7,9-10,12-13,18H,5,8,11,14H2,1-3H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | ICTFEQOOGHLRIR-GOSISDBHSA-N |
| XLogP | 4.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |