About 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid
3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid (PubChem CID 124965145) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid |
| PubChem CID | 124965145 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid |
| SMILES | CC(C)(C)C(=O)N1CCC[C@@H](c2cc(-c3cccc(C(=O)O)c3)ccn2)C1 |
| InChI | InChI=1S/C22H26N2O3/c1-22(2,3)21(27)24-11-5-8-18(14-24)19-13-16(9-10-23-19)15-6-4-7-17(12-15)20(25)26/h4,6-7,9-10,12-13,18H,5,8,11,14H2,1-3H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | ICTFEQOOGHLRIR-GOSISDBHSA-N |
| XLogP | 4.20 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid?
The IUPAC name of 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid (CID 124965145) is 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid.
What is the SMILES notation for 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid?
The canonical SMILES for 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid is CC(C)(C)C(=O)N1CCC[C@@H](c2cc(-c3cccc(C(=O)O)c3)ccn2)C1.
What is the InChIKey of 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid?
The InChIKey is ICTFEQOOGHLRIR-GOSISDBHSA-N. The full InChI is InChI=1S/C22H26N2O3/c1-22(2,3)21(27)24-11-5-8-18(14-24)19-13-16(9-10-23-19)15-6-4-7-17(12-15)20(25)26/h4,6-7,9-10,12-13,18H,5,8,11,14H2,1-3H3,(H,25,26)/t18-/m1/s1.
What are the key properties of 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid?
3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid has a molecular weight of 366.46 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(3R)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-4-pyridinyl]benzoic acid is sourced from PubChem (CID 124965145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).