About 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid
3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid (PubChem CID 124961442) has the molecular formula C21H25N3O3
and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid |
| PubChem CID | 124961442 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid |
| SMILES | CC(C)(C)C(=O)N1CC[C@@H](Cc2cc(-c3cccc(C(=O)O)c3)ncn2)C1 |
| InChI | InChI=1S/C21H25N3O3/c1-21(2,3)20(27)24-8-7-14(12-24)9-17-11-18(23-13-22-17)15-5-4-6-16(10-15)19(25)26/h4-6,10-11,13-14H,7-9,12H2,1-3H3,(H,25,26)/t14-/m0/s1 |
| InChIKey | HBODOAHHVKEABL-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid?
The IUPAC name of 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid (CID 124961442) is 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid.
What is the SMILES notation for 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid?
The canonical SMILES for 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid is CC(C)(C)C(=O)N1CC[C@@H](Cc2cc(-c3cccc(C(=O)O)c3)ncn2)C1.
What is the InChIKey of 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid?
The InChIKey is HBODOAHHVKEABL-AWEZNQCLSA-N. The full InChI is InChI=1S/C21H25N3O3/c1-21(2,3)20(27)24-8-7-14(12-24)9-17-11-18(23-13-22-17)15-5-4-6-16(10-15)19(25)26/h4-6,10-11,13-14H,7-9,12H2,1-3H3,(H,25,26)/t14-/m0/s1.
What are the key properties of 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid?
3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid has a molecular weight of 367.45 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[[(3S)-1-(2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]pyrimidin-4-yl]benzoic acid is sourced from PubChem (CID 124961442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).