C21H25N3O4 — CID 175660609
3-[6-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazin-2-yl]benzoic acid (PubChem CID 175660609) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[6-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazin-2-yl]benzoic acid.
| Compound Name | 3-[6-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175660609 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3-[6-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazin-2-yl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cncc(-c3cccc(C(=O)O)c3)n2)CC1 |
| InChI | InChI=1S/C21H25N3O4/c1-21(2,3)28-20(27)24-9-7-14(8-10-24)17-12-22-13-18(23-17)15-5-4-6-16(11-15)19(25)26/h4-6,11-14H,7-10H2,1-3H3,(H,25,26) |
| InChIKey | VNPZFGOWRYJZEZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |