C23H29N3O4 — CID 175660541
3-[6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]methyl]pyrazin-2-yl]benzoic acid (PubChem CID 175660541) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-[6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]methyl]pyrazin-2-yl]benzoic acid.
| Compound Name | 3-[6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]methyl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175660541 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 3-[6-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azepan-4-yl]methyl]pyrazin-2-yl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Cc2cncc(-c3cccc(C(=O)O)c3)n2)CC1 |
| InChI | InChI=1S/C23H29N3O4/c1-23(2,3)30-22(29)26-10-5-6-16(9-11-26)12-19-14-24-15-20(25-19)17-7-4-8-18(13-17)21(27)28/h4,7-8,13-16H,5-6,9-12H2,1-3H3,(H,27,28) |
| InChIKey | VGPBNJZMYXLQCK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |