C21H26ClN3O2 — CID 175281835
tert-butyl 4-[[6-(5-chloro-2-pyridinyl)-2-pyridinyl]methyl]piperidine-1-carboxylate (PubChem CID 175281835) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is tert-butyl 4-[[6-(5-chloro-2-pyridinyl)-2-pyridinyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-(5-chloro-2-pyridinyl)-2-pyridinyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175281835 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | tert-butyl 4-[[6-(5-chloro-2-pyridinyl)-2-pyridinyl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2cccc(-c3ccc(Cl)cn3)n2)CC1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-21(2,3)27-20(26)25-11-9-15(10-12-25)13-17-5-4-6-19(24-17)18-8-7-16(22)14-23-18/h4-8,14-15H,9-13H2,1-3H3 |
| InChIKey | LUVUQSIQOGJABU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |