C16H23ClN2O2 — CID 157407419
tert-butyl (3S)-3-[(5-chloro-4-methyl-2-pyridinyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 157407419) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5-chloro-4-methyl-2-pyridinyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(5-chloro-4-methyl-2-pyridinyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157407419 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl (3S)-3-[(5-chloro-4-methyl-2-pyridinyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C[C@@H]2CCN(C(=O)OC(C)(C)C)C2)ncc1Cl |
| InChI | InChI=1S/C16H23ClN2O2/c1-11-7-13(18-9-14(11)17)8-12-5-6-19(10-12)15(20)21-16(2,3)4/h7,9,12H,5-6,8,10H2,1-4H3/t12-/m0/s1 |
| InChIKey | ZBVLKVCZCGMJCC-LBPRGKRZSA-N |
| XLogP | 3.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |