C18H23ClN4O2 — CID 118166904
tert-butyl 4-[1-(5-chloro-2-pyridinyl)pyrazol-3-yl]piperidine-1-carboxylate (PubChem CID 118166904) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is tert-butyl 4-[1-(5-chloro-2-pyridinyl)pyrazol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(5-chloro-2-pyridinyl)pyrazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118166904 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | tert-butyl 4-[1-(5-chloro-2-pyridinyl)pyrazol-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccn(-c3ccc(Cl)cn3)n2)CC1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-18(2,3)25-17(24)22-9-6-13(7-10-22)15-8-11-23(21-15)16-5-4-14(19)12-20-16/h4-5,8,11-13H,6-7,9-10H2,1-3H3 |
| InChIKey | AOWSIZSDJJQYTJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |