C18H25N5O2 — CID 124942430
tert-butyl (3S)-3-[[6-(1H-pyrazol-4-yl)pyrazin-2-yl]methyl]piperidine-1-carboxylate (PubChem CID 124942430) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[6-(1H-pyrazol-4-yl)pyrazin-2-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[6-(1H-pyrazol-4-yl)pyrazin-2-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124942430 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | tert-butyl (3S)-3-[[6-(1H-pyrazol-4-yl)pyrazin-2-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Cc2cncc(-c3cn[nH]c3)n2)C1 |
| InChI | InChI=1S/C18H25N5O2/c1-18(2,3)25-17(24)23-6-4-5-13(12-23)7-15-10-19-11-16(22-15)14-8-20-21-9-14/h8-11,13H,4-7,12H2,1-3H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | AUXIDZXRGWOQDX-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |