C14H19N5O2S — CID 124945514
2-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1H-pyrazol-4-yl)pyrazine (PubChem CID 124945514) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1H-pyrazol-4-yl)pyrazine.
| Compound Name | 2-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1H-pyrazol-4-yl)pyrazine |
|---|---|
| PubChem CID | 124945514 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1H-pyrazol-4-yl)pyrazine |
| SMILES | CS(=O)(=O)N1CCC[C@H](Cc2cncc(-c3cn[nH]c3)n2)C1 |
| InChI | InChI=1S/C14H19N5O2S/c1-22(20,21)19-4-2-3-11(10-19)5-13-8-15-9-14(18-13)12-6-16-17-7-12/h6-9,11H,2-5,10H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | BROAVWJCMOSSAN-LLVKDONJSA-N |
| XLogP | 1.08 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |