C17H25N5O2S — CID 124998163
2-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1-propylpyrazol-4-yl)pyrazine (PubChem CID 124998163) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1-propylpyrazol-4-yl)pyrazine.
| Compound Name | 2-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1-propylpyrazol-4-yl)pyrazine |
|---|---|
| PubChem CID | 124998163 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-6-(1-propylpyrazol-4-yl)pyrazine |
| SMILES | CCCn1cc(-c2cncc(C[C@@H]3CCCN(S(C)(=O)=O)C3)n2)cn1 |
| InChI | InChI=1S/C17H25N5O2S/c1-3-6-21-13-15(9-19-21)17-11-18-10-16(20-17)8-14-5-4-7-22(12-14)25(2,23)24/h9-11,13-14H,3-8,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | RFTNMYJRACQYIC-AWEZNQCLSA-N |
| XLogP | 1.96 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |