C15H21N5O2S — CID 124995645
4-(5-methyl-1H-pyrazol-3-yl)-6-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine (PubChem CID 124995645) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-(5-methyl-1H-pyrazol-3-yl)-6-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine.
| Compound Name | 4-(5-methyl-1H-pyrazol-3-yl)-6-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 124995645 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-(5-methyl-1H-pyrazol-3-yl)-6-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine |
| SMILES | Cc1cc(-c2cc(C[C@@H]3CCCN(S(C)(=O)=O)C3)ncn2)n[nH]1 |
| InChI | InChI=1S/C15H21N5O2S/c1-11-6-15(19-18-11)14-8-13(16-10-17-14)7-12-4-3-5-20(9-12)23(2,21)22/h6,8,10,12H,3-5,7,9H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | QNOXGFXGAJATRM-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |