C16H23N5O2S — CID 124964395
4-(2-ethylpyrazol-3-yl)-6-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine (PubChem CID 124964395) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-(2-ethylpyrazol-3-yl)-6-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine.
| Compound Name | 4-(2-ethylpyrazol-3-yl)-6-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 124964395 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-(2-ethylpyrazol-3-yl)-6-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]pyrimidine |
| SMILES | CCn1nccc1-c1cc(C[C@H]2CCCN(S(C)(=O)=O)C2)ncn1 |
| InChI | InChI=1S/C16H23N5O2S/c1-3-21-16(6-7-19-21)15-10-14(17-12-18-15)9-13-5-4-8-20(11-13)24(2,22)23/h6-7,10,12-13H,3-5,8-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | HXHIFICCJWIYNR-CYBMUJFWSA-N |
| XLogP | 1.57 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |