C16H22N4O2S — CID 124988141
2-(2-ethylpyrazol-3-yl)-6-[(3S)-1-methylsulfonylpiperidin-3-yl]pyridine (PubChem CID 124988141) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-(2-ethylpyrazol-3-yl)-6-[(3S)-1-methylsulfonylpiperidin-3-yl]pyridine.
| Compound Name | 2-(2-ethylpyrazol-3-yl)-6-[(3S)-1-methylsulfonylpiperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 124988141 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(2-ethylpyrazol-3-yl)-6-[(3S)-1-methylsulfonylpiperidin-3-yl]pyridine |
| SMILES | CCn1nccc1-c1cccc([C@H]2CCCN(S(C)(=O)=O)C2)n1 |
| InChI | InChI=1S/C16H22N4O2S/c1-3-20-16(9-10-17-20)15-8-4-7-14(18-15)13-6-5-11-19(12-13)23(2,21)22/h4,7-10,13H,3,5-6,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | OKWXZJTWPJUGQU-ZDUSSCGKSA-N |
| XLogP | 2.10 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |