C24H24ClN3O — CID 95819705
1-[(3R)-3-[6-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 95819705) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 1-[(3R)-3-[6-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[(3R)-3-[6-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 95819705 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[(3R)-3-[6-(3-chlorophenyl)pyrazin-2-yl]piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCC[C@@H](c2cncc(-c3cccc(Cl)c3)n2)C1 |
| InChI | InChI=1S/C24H24ClN3O/c25-21-10-4-8-19(14-21)22-15-26-16-23(27-22)20-9-5-13-28(17-20)24(29)12-11-18-6-2-1-3-7-18/h1-4,6-8,10,14-16,20H,5,9,11-13,17H2/t20-/m1/s1 |
| InChIKey | OXLZFXBWXCAPRC-HXUWFJFHSA-N |
| XLogP | 5.14 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |