C25H26FN3O — CID 95820069
1-[4-[6-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-4-phenylbutan-1-one (PubChem CID 95820069) has the molecular formula C25H26FN3O and a molecular weight of 403.50 g/mol. Its IUPAC name is 1-[4-[6-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-[6-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 95820069 |
| Molecular Formula | C25H26FN3O |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[4-[6-(3-fluorophenyl)pyrazin-2-yl]piperidin-1-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCC(c2cncc(-c3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C25H26FN3O/c26-22-10-5-9-21(16-22)24-18-27-17-23(28-24)20-12-14-29(15-13-20)25(30)11-4-8-19-6-2-1-3-7-19/h1-3,5-7,9-10,16-18,20H,4,8,11-15H2 |
| InChIKey | OZNJUSCCRCDPDE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |