C17H24F2IN3 — CID 120671744
N'-[3-(3,5-difluorophenyl)cyclobutyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 120671744) has the molecular formula C17H24F2IN3 and a molecular weight of 435.30 g/mol. Its IUPAC name is N'-[3-(3,5-difluorophenyl)cyclobutyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(3,5-difluorophenyl)cyclobutyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120671744 |
| Molecular Formula | C17H24F2IN3 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N'-[3-(3,5-difluorophenyl)cyclobutyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/C2CC(c3cc(F)cc(F)c3)C2)C1.I |
| InChI | InChI=1S/C17H23F2N3.HI/c1-11-3-2-4-22(10-11)17(20)21-16-7-13(8-16)12-5-14(18)9-15(19)6-12;/h5-6,9,11,13,16H,2-4,7-8,10H2,1H3,(H2,20,21);1H |
| InChIKey | GIMQLPDFBNSQTL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|