C13H26IN3 — CID 120666131
3-methyl-N'-[(1R,2R)-2-propylcyclopropyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 120666131) has the molecular formula C13H26IN3 and a molecular weight of 351.28 g/mol. Its IUPAC name is 3-methyl-N'-[(1R,2R)-2-propylcyclopropyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-methyl-N'-[(1R,2R)-2-propylcyclopropyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120666131 |
| Molecular Formula | C13H26IN3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-methyl-N'-[(1R,2R)-2-propylcyclopropyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCC[C@@H]1C[C@H]1/N=C(\N)N1CCCC(C)C1.I |
| InChI | InChI=1S/C13H25N3.HI/c1-3-5-11-8-12(11)15-13(14)16-7-4-6-10(2)9-16;/h10-12H,3-9H2,1-2H3,(H2,14,15);1H/t10?,11-,12-;/m1./s1 |
| InChIKey | POAOVJOXRZOTHD-ILRKGUEASA-N |
| XLogP | 2.84 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|