C16H32N4 — CID 111042541
3-methyl-N'-(3-methyl-2-pyrrolidin-1-ylbutyl)piperidine-1-carboximidamide (PubChem CID 111042541) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 3-methyl-N'-(3-methyl-2-pyrrolidin-1-ylbutyl)piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-(3-methyl-2-pyrrolidin-1-ylbutyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111042541 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 3-methyl-N'-(3-methyl-2-pyrrolidin-1-ylbutyl)piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CC(C(C)C)N2CCCC2)C1 |
| InChI | InChI=1S/C16H32N4/c1-13(2)15(19-8-4-5-9-19)11-18-16(17)20-10-6-7-14(3)12-20/h13-15H,4-12H2,1-3H3,(H2,17,18) |
| InChIKey | PTJLPZUPBOQVML-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|