C13H24IN3OS — CID 111815663
N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111815663) has the molecular formula C13H24IN3OS and a molecular weight of 397.33 g/mol. Its IUPAC name is N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111815663 |
| Molecular Formula | C13H24IN3OS |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1(C)C(/N=C(\N)N2CCSCC2)C2CCOC21.I |
| InChI | InChI=1S/C13H23N3OS.HI/c1-13(2)10(9-3-6-17-11(9)13)15-12(14)16-4-7-18-8-5-16;/h9-11H,3-8H2,1-2H3,(H2,14,15);1H |
| InChIKey | XTCGXMKHXHLPGQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|