About N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide
N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111815663) has the molecular formula C13H24IN3OS
and a molecular weight of 397.33 g/mol. Its IUPAC name is N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide |
| PubChem CID | 111815663 |
| Molecular Formula | C13H24IN3OS |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1(C)C(/N=C(\N)N2CCSCC2)C2CCOC21.I |
| InChI | InChI=1S/C13H23N3OS.HI/c1-13(2)10(9-3-6-17-11(9)13)15-12(14)16-4-7-18-8-5-16;/h9-11H,3-8H2,1-2H3,(H2,14,15);1H |
| InChIKey | XTCGXMKHXHLPGQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide?
The IUPAC name of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide (CID 111815663) is N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide.
What is the SMILES notation for N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide?
The canonical SMILES for N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide is CC1(C)C(/N=C(\N)N2CCSCC2)C2CCOC21.I.
What is the InChIKey of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide?
The InChIKey is XTCGXMKHXHLPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3OS.HI/c1-13(2)10(9-3-6-17-11(9)13)15-12(14)16-4-7-18-8-5-16;/h9-11H,3-8H2,1-2H3,(H2,14,15);1H.
What are the key properties of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide?
N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide has a molecular weight of 397.33 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)thiomorpholine-4-carboximidamide;hydroiodide is sourced from PubChem (CID 111815663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).