C14H26IN3O2 — CID 119148238
N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 119148238) has the molecular formula C14H26IN3O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119148238 |
| Molecular Formula | C14H26IN3O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC1(C)C(/N=C(\N)N2CCOCC2)C2CCCOC21.I |
| InChI | InChI=1S/C14H25N3O2.HI/c1-14(2)11(10-4-3-7-19-12(10)14)16-13(15)17-5-8-18-9-6-17;/h10-12H,3-9H2,1-2H3,(H2,15,16);1H |
| InChIKey | CBPOIXGHUXYRHH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|