C20H30FIN4O — CID 119148272
N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119148272) has the molecular formula C20H30FIN4O and a molecular weight of 488.39 g/mol. Its IUPAC name is N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119148272 |
| Molecular Formula | C20H30FIN4O |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N'-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC1(C)C(/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)C2CCCOC21.I |
| InChI | InChI=1S/C20H29FN4O.HI/c1-20(2)17(16-4-3-13-26-18(16)20)23-19(22)25-11-9-24(10-12-25)15-7-5-14(21)6-8-15;/h5-8,16-18H,3-4,9-13H2,1-2H3,(H2,22,23);1H |
| InChIKey | ZBFNQIVJKFYQTP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|