About [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone
[(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone (PubChem CID 130676353) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone |
| PubChem CID | 130676353 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone |
| SMILES | CC1(C)C[C@@H]1C(=O)N1CCSCC1 |
| InChI | InChI=1S/C10H17NOS/c1-10(2)7-8(10)9(12)11-3-5-13-6-4-11/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | NVYIEGUYLXVZCW-MRVPVSSYSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone?
The IUPAC name of [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone (CID 130676353) is [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone.
What is the SMILES notation for [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone?
The canonical SMILES for [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone is CC1(C)C[C@@H]1C(=O)N1CCSCC1.
What is the InChIKey of [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone?
The InChIKey is NVYIEGUYLXVZCW-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H17NOS/c1-10(2)7-8(10)9(12)11-3-5-13-6-4-11/h8H,3-7H2,1-2H3/t8-/m1/s1.
What are the key properties of [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone?
[(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone has a molecular weight of 199.32 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-dimethylcyclopropyl]-thiomorpholin-4-ylmethanone is sourced from PubChem (CID 130676353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).