About N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide
N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide (PubChem CID 107455922) has the molecular formula C13H25N3S
and a molecular weight of 255.43 g/mol. Its IUPAC name is N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide.
Molecular Properties
| Compound Name | N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide |
| PubChem CID | 107455922 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide |
| SMILES | CC1(C)CCN(/C(N)=N/C2CCCC2)CCS1 |
| InChI | InChI=1S/C13H25N3S/c1-13(2)7-8-16(9-10-17-13)12(14)15-11-5-3-4-6-11/h11H,3-10H2,1-2H3,(H2,14,15) |
| InChIKey | ZPEHDXQFIYTNCZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide?
The IUPAC name of N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide (CID 107455922) is N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide.
What is the SMILES notation for N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide?
The canonical SMILES for N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide is CC1(C)CCN(/C(N)=N/C2CCCC2)CCS1.
What is the InChIKey of N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide?
The InChIKey is ZPEHDXQFIYTNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3S/c1-13(2)7-8-16(9-10-17-13)12(14)15-11-5-3-4-6-11/h11H,3-10H2,1-2H3,(H2,14,15).
What are the key properties of N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide?
N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide has a molecular weight of 255.43 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide is sourced from PubChem (CID 107455922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).