C14H28N4S — CID 107460335
N-amino-N'-cyclohexyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide (PubChem CID 107460335) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is N-amino-N'-cyclohexyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide.
| Compound Name | N-amino-N'-cyclohexyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide |
|---|---|
| PubChem CID | 107460335 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-amino-N'-cyclohexyl-7,7-dimethyl-1,4-thiazepane-4-carboximidamide |
| SMILES | CC1(C)CCN(/C(=N/C2CCCCC2)NN)CCS1 |
| InChI | InChI=1S/C14H28N4S/c1-14(2)8-9-18(10-11-19-14)13(17-15)16-12-6-4-3-5-7-12/h12H,3-11,15H2,1-2H3,(H,16,17) |
| InChIKey | JDGYZSUOJTUTCV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|