C11H22N2S2 — CID 107265793
7,7-dimethyl-N-propan-2-yl-1,4-thiazepane-4-carbothioamide (PubChem CID 107265793) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 7,7-dimethyl-N-propan-2-yl-1,4-thiazepane-4-carbothioamide.
| Compound Name | 7,7-dimethyl-N-propan-2-yl-1,4-thiazepane-4-carbothioamide |
|---|---|
| PubChem CID | 107265793 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 7,7-dimethyl-N-propan-2-yl-1,4-thiazepane-4-carbothioamide |
| SMILES | CC(C)NC(=S)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C11H22N2S2/c1-9(2)12-10(14)13-6-5-11(3,4)15-8-7-13/h9H,5-8H2,1-4H3,(H,12,14) |
| InChIKey | FODRTLQPLWNVHL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|