C12H20N2O5S — CID 107457572
(2S)-2-[(7,7-dimethyl-1,4-thiazepane-4-carbonyl)amino]butanedioic acid (PubChem CID 107457572) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is (2S)-2-[(7,7-dimethyl-1,4-thiazepane-4-carbonyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(7,7-dimethyl-1,4-thiazepane-4-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 107457572 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2S)-2-[(7,7-dimethyl-1,4-thiazepane-4-carbonyl)amino]butanedioic acid |
| SMILES | CC1(C)CCN(C(=O)N[C@@H](CC(=O)O)C(=O)O)CCS1 |
| InChI | InChI=1S/C12H20N2O5S/c1-12(2)3-4-14(5-6-20-12)11(19)13-8(10(17)18)7-9(15)16/h8H,3-7H2,1-2H3,(H,13,19)(H,15,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | BEWNQTMGMQSIOW-QMMMGPOBSA-N |
| XLogP | 0.84 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |