C12H21NO2S — CID 107454936
1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentane-1,4-dione (PubChem CID 107454936) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentane-1,4-dione.
| Compound Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentane-1,4-dione |
|---|---|
| PubChem CID | 107454936 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C12H21NO2S/c1-10(14)4-5-11(15)13-7-6-12(2,3)16-9-8-13/h4-9H2,1-3H3 |
| InChIKey | GARPBWRYPQFLRJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |