C14H28N4 — CID 104886543
N-amino-N'-cyclopentyl-4,4-dimethylazepane-1-carboximidamide (PubChem CID 104886543) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-4,4-dimethylazepane-1-carboximidamide.
| Compound Name | N-amino-N'-cyclopentyl-4,4-dimethylazepane-1-carboximidamide |
|---|---|
| PubChem CID | 104886543 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N-amino-N'-cyclopentyl-4,4-dimethylazepane-1-carboximidamide |
| SMILES | CC1(C)CCCN(/C(=N/C2CCCC2)NN)CC1 |
| InChI | InChI=1S/C14H28N4/c1-14(2)8-5-10-18(11-9-14)13(17-15)16-12-6-3-4-7-12/h12H,3-11,15H2,1-2H3,(H,16,17) |
| InChIKey | HGNQVPCZKDLJAE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|