C11H20F3IN4S — CID 111085552
N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111085552) has the molecular formula C11H20F3IN4S and a molecular weight of 424.27 g/mol. Its IUPAC name is N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111085552 |
| Molecular Formula | C11H20F3IN4S |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\C1CCN(CC(F)(F)F)C1)N1CCSCC1 |
| InChI | InChI=1S/C11H19F3N4S.HI/c12-11(13,14)8-17-2-1-9(7-17)16-10(15)18-3-5-19-6-4-18;/h9H,1-8H2,(H2,15,16);1H |
| InChIKey | NQRLJFDITHLBPB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|