C15H22N4O — CID 111097765
1-tert-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine (PubChem CID 111097765) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine |
|---|---|
| PubChem CID | 111097765 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-tert-butyl-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H22N4O/c1-15(2,3)18-14(16)17-10-13(20)19-9-8-11-6-4-5-7-12(11)19/h4-7H,8-10H2,1-3H3,(H3,16,17,18) |
| InChIKey | MMYJUNBCBMWDEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|