C18H20N4O — CID 111097779
2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(4-methylphenyl)guanidine (PubChem CID 111097779) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(4-methylphenyl)guanidine.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111097779 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H20N4O/c1-13-6-8-15(9-7-13)21-18(19)20-12-17(23)22-11-10-14-4-2-3-5-16(14)22/h2-9H,10-12H2,1H3,(H3,19,20,21) |
| InChIKey | PYKINACOWSBMLU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|