C13H17ClN2O2 — CID 110639469
6-chloro-N,N-diethyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide (PubChem CID 110639469) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 6-chloro-N,N-diethyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
| Compound Name | 6-chloro-N,N-diethyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
|---|---|
| PubChem CID | 110639469 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-chloro-N,N-diethyl-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H17ClN2O2/c1-3-15(4-2)13(17)16-7-8-18-12-6-5-10(14)9-11(12)16/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | BCUDUYDURDSNFK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |