C16H14ClNO3 — CID 110639446
1-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-phenoxyethanone (PubChem CID 110639446) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-phenoxyethanone.
| Compound Name | 1-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-phenoxyethanone |
|---|---|
| PubChem CID | 110639446 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-(6-chloro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClNO3/c17-12-6-7-15-14(10-12)18(8-9-20-15)16(19)11-21-13-4-2-1-3-5-13/h1-7,10H,8-9,11H2 |
| InChIKey | VJTDETJPDJMKFU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |