C14H12INO2S — CID 112703214
3,4-dihydro-2H-1,5-benzoxazepin-5-yl-(5-iodothiophen-3-yl)methanone (PubChem CID 112703214) has the molecular formula C14H12INO2S and a molecular weight of 385.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzoxazepin-5-yl-(5-iodothiophen-3-yl)methanone.
| Compound Name | 3,4-dihydro-2H-1,5-benzoxazepin-5-yl-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 112703214 |
| Molecular Formula | C14H12INO2S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzoxazepin-5-yl-(5-iodothiophen-3-yl)methanone |
| SMILES | O=C(c1csc(I)c1)N1CCCOc2ccccc21 |
| InChI | InChI=1S/C14H12INO2S/c15-13-8-10(9-19-13)14(17)16-6-3-7-18-12-5-2-1-4-11(12)16/h1-2,4-5,8-9H,3,6-7H2 |
| InChIKey | SXHBMLAULRRMRF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|