C16H13ClINO2 — CID 103827372
(5-chloro-2-iodophenyl)-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)methanone (PubChem CID 103827372) has the molecular formula C16H13ClINO2 and a molecular weight of 413.64 g/mol. Its IUPAC name is (5-chloro-2-iodophenyl)-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)methanone.
| Compound Name | (5-chloro-2-iodophenyl)-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)methanone |
|---|---|
| PubChem CID | 103827372 |
| Molecular Formula | C16H13ClINO2 |
| Molecular Weight | 413.64 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | (5-chloro-2-iodophenyl)-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)methanone |
| SMILES | O=C(c1cc(Cl)ccc1I)N1CCCOc2ccccc21 |
| InChI | InChI=1S/C16H13ClINO2/c17-11-6-7-13(18)12(10-11)16(20)19-8-3-9-21-15-5-2-1-4-14(15)19/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | NLMRZFGVOHSJNM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|