C15H20N2OS — CID 116509884
N-cyclopentyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carbothioamide (PubChem CID 116509884) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N-cyclopentyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carbothioamide.
| Compound Name | N-cyclopentyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carbothioamide |
|---|---|
| PubChem CID | 116509884 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-cyclopentyl-3,4-dihydro-2H-1,5-benzoxazepine-5-carbothioamide |
| SMILES | S=C(NC1CCCC1)N1CCCOc2ccccc21 |
| InChI | InChI=1S/C15H20N2OS/c19-15(16-12-6-1-2-7-12)17-10-5-11-18-14-9-4-3-8-13(14)17/h3-4,8-9,12H,1-2,5-7,10-11H2,(H,16,19) |
| InChIKey | WXEAVUQUCLVWMV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|